C14H24F3NO3 — CID 116538224
ethyl 3,3-dimethyl-2-(5,5,5-trifluoropentylcarbamoyl)butanoate (PubChem CID 116538224) has the molecular formula C14H24F3NO3 and a molecular weight of 311.34 g/mol. Its IUPAC name is ethyl 3,3-dimethyl-2-(5,5,5-trifluoropentylcarbamoyl)butanoate.
| Compound Name | ethyl 3,3-dimethyl-2-(5,5,5-trifluoropentylcarbamoyl)butanoate |
|---|---|
| PubChem CID | 116538224 |
| Molecular Formula | C14H24F3NO3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | ethyl 3,3-dimethyl-2-(5,5,5-trifluoropentylcarbamoyl)butanoate |
| SMILES | CCOC(=O)C(C(=O)NCCCCC(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C14H24F3NO3/c1-5-21-12(20)10(13(2,3)4)11(19)18-9-7-6-8-14(15,16)17/h10H,5-9H2,1-4H3,(H,18,19) |
| InChIKey | AERBRRAEMQAMAO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|