C10H15NO — CID 116538755
3-(furan-3-yl)-3-methylcyclopentan-1-amine (PubChem CID 116538755) has the molecular formula C10H15NO and a molecular weight of 165.24 g/mol. Its IUPAC name is 3-(furan-3-yl)-3-methylcyclopentan-1-amine.
| Compound Name | 3-(furan-3-yl)-3-methylcyclopentan-1-amine |
|---|---|
| PubChem CID | 116538755 |
| Molecular Formula | C10H15NO |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.12 |
| IUPAC Name | 3-(furan-3-yl)-3-methylcyclopentan-1-amine |
| SMILES | CC1(c2ccoc2)CCC(N)C1 |
| InChI | InChI=1S/C10H15NO/c1-10(4-2-9(11)6-10)8-3-5-12-7-8/h3,5,7,9H,2,4,6,11H2,1H3 |
| InChIKey | RKZBDMQUFHVCLT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 39.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |