About 3-benzyl-N,3-dimethylcyclopentan-1-amine
3-benzyl-N,3-dimethylcyclopentan-1-amine (PubChem CID 116538980) has the molecular formula C14H21N
and a molecular weight of 203.33 g/mol. Its IUPAC name is 3-benzyl-N,3-dimethylcyclopentan-1-amine.
Molecular Properties
| Compound Name | 3-benzyl-N,3-dimethylcyclopentan-1-amine |
| PubChem CID | 116538980 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 3-benzyl-N,3-dimethylcyclopentan-1-amine |
| SMILES | CNC1CCC(C)(Cc2ccccc2)C1 |
| InChI | InChI=1S/C14H21N/c1-14(9-8-13(11-14)15-2)10-12-6-4-3-5-7-12/h3-7,13,15H,8-11H2,1-2H3 |
| InChIKey | SXRQMBCWPGEPHZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-benzyl-N,3-dimethylcyclopentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-benzyl-N,3-dimethylcyclopentan-1-amine?
The IUPAC name of 3-benzyl-N,3-dimethylcyclopentan-1-amine (CID 116538980) is 3-benzyl-N,3-dimethylcyclopentan-1-amine.
What is the SMILES notation for 3-benzyl-N,3-dimethylcyclopentan-1-amine?
The canonical SMILES for 3-benzyl-N,3-dimethylcyclopentan-1-amine is CNC1CCC(C)(Cc2ccccc2)C1.
What is the InChIKey of 3-benzyl-N,3-dimethylcyclopentan-1-amine?
The InChIKey is SXRQMBCWPGEPHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N/c1-14(9-8-13(11-14)15-2)10-12-6-4-3-5-7-12/h3-7,13,15H,8-11H2,1-2H3.
What are the key properties of 3-benzyl-N,3-dimethylcyclopentan-1-amine?
3-benzyl-N,3-dimethylcyclopentan-1-amine has a molecular weight of 203.33 g/mol, XLogP of 3.01, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-benzyl-N,3-dimethylcyclopentan-1-amine is sourced from PubChem (CID 116538980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).