C21H28O7 — CID 11654026
ethyl (E)-3-[(1S,3R,6R,7R,10R)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-3-methoxy-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-10-yl]prop-2-enoate (PubChem CID 11654026) has the molecular formula C21H28O7 and a molecular weight of 392.45 g/mol. Its IUPAC name is ethyl (E)-3-[(1S,3R,6R,7R,10R)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-3-methoxy-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-10-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[(1S,3R,6R,7R,10R)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-3-methoxy-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-10-yl]prop-2-enoate |
|---|---|
| PubChem CID | 11654026 |
| Molecular Formula | C21H28O7 |
| Molecular Weight | 392.45 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | ethyl (E)-3-[(1S,3R,6R,7R,10R)-8-(5,5-dimethyl-1,3-dioxan-2-yl)-3-methoxy-2-oxo-4-oxatricyclo[4.3.1.03,7]dec-8-en-10-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@@H]1[C@H]2CO[C@@]3(OC)C(=O)[C@@H]1C=C(C1OCC(C)(C)CO1)[C@@H]23 |
| InChI | InChI=1S/C21H28O7/c1-5-25-16(22)7-6-12-13-8-14(19-26-10-20(2,3)11-27-19)17-15(12)9-28-21(17,24-4)18(13)23/h6-8,12-13,15,17,19H,5,9-11H2,1-4H3/b7-6+/t12-,13+,15+,17-,21+/m0/s1 |
| InChIKey | JGUSGUCNKFBXGS-FWNAVYHESA-N |
| XLogP | 1.87 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.45 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|