C19H27N3O4S — CID 11654060
(2R,3R,4S,5R,6S)-2-(azidomethyl)-4,5-dimethoxy-3-pent-4-enoxy-6-phenylsulfanyloxane (PubChem CID 11654060) has the molecular formula C19H27N3O4S and a molecular weight of 393.51 g/mol. Its IUPAC name is (2R,3R,4S,5R,6S)-2-(azidomethyl)-4,5-dimethoxy-3-pent-4-enoxy-6-phenylsulfanyloxane.
| Compound Name | (2R,3R,4S,5R,6S)-2-(azidomethyl)-4,5-dimethoxy-3-pent-4-enoxy-6-phenylsulfanyloxane |
|---|---|
| PubChem CID | 11654060 |
| Molecular Formula | C19H27N3O4S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (2R,3R,4S,5R,6S)-2-(azidomethyl)-4,5-dimethoxy-3-pent-4-enoxy-6-phenylsulfanyloxane |
| SMILES | C=CCCCO[C@H]1[C@H](OC)[C@@H](OC)[C@H](Sc2ccccc2)O[C@@H]1CN=[N+]=[N-] |
| InChI | InChI=1S/C19H27N3O4S/c1-4-5-9-12-25-16-15(13-21-22-20)26-19(18(24-3)17(16)23-2)27-14-10-7-6-8-11-14/h4,6-8,10-11,15-19H,1,5,9,12-13H2,2-3H3/t15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | VYHGSHHEKNYTHN-FQBWVUSXSA-N |
| XLogP | 4.20 |
| TPSA | 85.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|