C20H17N3O6 — CID 11654098
N-(3-methoxyphenyl)-N'-(1,3,4-trioxoisoquinolin-6-yl)butanediamide (PubChem CID 11654098) has the molecular formula C20H17N3O6 and a molecular weight of 395.37 g/mol. Its IUPAC name is N-(3-methoxyphenyl)-N'-(1,3,4-trioxoisoquinolin-6-yl)butanediamide.
| Compound Name | N-(3-methoxyphenyl)-N'-(1,3,4-trioxoisoquinolin-6-yl)butanediamide |
|---|---|
| PubChem CID | 11654098 |
| Molecular Formula | C20H17N3O6 |
| Molecular Weight | 395.37 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | N-(3-methoxyphenyl)-N'-(1,3,4-trioxoisoquinolin-6-yl)butanediamide |
| SMILES | COc1cccc(NC(=O)CCC(=O)Nc2ccc3c(c2)C(=O)C(=O)NC3=O)c1 |
| InChI | InChI=1S/C20H17N3O6/c1-29-13-4-2-3-11(9-13)21-16(24)7-8-17(25)22-12-5-6-14-15(10-12)18(26)20(28)23-19(14)27/h2-6,9-10H,7-8H2,1H3,(H,21,24)(H,22,25)(H,23,27,28) |
| InChIKey | OTSSFDPOZPHLHY-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 130.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.37 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|