C20H26O — CID 116542789
1-(3,5-dimethylphenyl)-1-[3-(2-methylpropyl)phenyl]ethanol (PubChem CID 116542789) has the molecular formula C20H26O and a molecular weight of 282.43 g/mol. Its IUPAC name is 1-(3,5-dimethylphenyl)-1-[3-(2-methylpropyl)phenyl]ethanol.
| Compound Name | 1-(3,5-dimethylphenyl)-1-[3-(2-methylpropyl)phenyl]ethanol |
|---|---|
| PubChem CID | 116542789 |
| Molecular Formula | C20H26O |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.20 |
| IUPAC Name | 1-(3,5-dimethylphenyl)-1-[3-(2-methylpropyl)phenyl]ethanol |
| SMILES | Cc1cc(C)cc(C(C)(O)c2cccc(CC(C)C)c2)c1 |
| InChI | InChI=1S/C20H26O/c1-14(2)9-17-7-6-8-18(13-17)20(5,21)19-11-15(3)10-16(4)12-19/h6-8,10-14,21H,9H2,1-5H3 |
| InChIKey | FQPSNYDGUJGHCH-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |