C19H26ClFO6 — CID 11654335
(2S,3R,4R,5S,6S)-2-[4-chloro-3-(4-methoxycyclohexyl)oxyphenyl]-6-(fluoromethyl)oxane-3,4,5-triol (PubChem CID 11654335) has the molecular formula C19H26ClFO6 and a molecular weight of 404.86 g/mol. Its IUPAC name is (2S,3R,4R,5S,6S)-2-[4-chloro-3-(4-methoxycyclohexyl)oxyphenyl]-6-(fluoromethyl)oxane-3,4,5-triol.
| Compound Name | (2S,3R,4R,5S,6S)-2-[4-chloro-3-(4-methoxycyclohexyl)oxyphenyl]-6-(fluoromethyl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11654335 |
| Molecular Formula | C19H26ClFO6 |
| Molecular Weight | 404.86 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | (2S,3R,4R,5S,6S)-2-[4-chloro-3-(4-methoxycyclohexyl)oxyphenyl]-6-(fluoromethyl)oxane-3,4,5-triol |
| SMILES | COC1CCC(Oc2cc([C@@H]3O[C@H](CF)[C@@H](O)[C@H](O)[C@H]3O)ccc2Cl)CC1 |
| InChI | InChI=1S/C19H26ClFO6/c1-25-11-3-5-12(6-4-11)26-14-8-10(2-7-13(14)20)19-18(24)17(23)16(22)15(9-21)27-19/h2,7-8,11-12,15-19,22-24H,3-6,9H2,1H3/t11?,12?,15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | GBKZPPKZSFCGCY-UFEWFIOWSA-N |
| XLogP | 2.17 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.86 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |