C17H29NO — CID 116544166
N-[2-propoxy-1-(3-propylphenyl)ethyl]propan-1-amine (PubChem CID 116544166) has the molecular formula C17H29NO and a molecular weight of 263.42 g/mol. Its IUPAC name is N-[2-propoxy-1-(3-propylphenyl)ethyl]propan-1-amine.
| Compound Name | N-[2-propoxy-1-(3-propylphenyl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 116544166 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.42 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | N-[2-propoxy-1-(3-propylphenyl)ethyl]propan-1-amine |
| SMILES | CCCNC(COCCC)c1cccc(CCC)c1 |
| InChI | InChI=1S/C17H29NO/c1-4-8-15-9-7-10-16(13-15)17(18-11-5-2)14-19-12-6-3/h7,9-10,13,17-18H,4-6,8,11-12,14H2,1-3H3 |
| InChIKey | LFTQZTRNWLKUNP-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|