C19H26N2 — CID 116544214
N-ethyl-1-[3-(2-methylpropyl)phenyl]-2-pyridin-3-ylethanamine (PubChem CID 116544214) has the molecular formula C19H26N2 and a molecular weight of 282.43 g/mol. Its IUPAC name is N-ethyl-1-[3-(2-methylpropyl)phenyl]-2-pyridin-3-ylethanamine.
| Compound Name | N-ethyl-1-[3-(2-methylpropyl)phenyl]-2-pyridin-3-ylethanamine |
|---|---|
| PubChem CID | 116544214 |
| Molecular Formula | C19H26N2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-ethyl-1-[3-(2-methylpropyl)phenyl]-2-pyridin-3-ylethanamine |
| SMILES | CCNC(Cc1cccnc1)c1cccc(CC(C)C)c1 |
| InChI | InChI=1S/C19H26N2/c1-4-21-19(13-17-8-6-10-20-14-17)18-9-5-7-16(12-18)11-15(2)3/h5-10,12,14-15,19,21H,4,11,13H2,1-3H3 |
| InChIKey | JZOLJSJADJJSTH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |