C20H33N — CID 116544896
N-[cyclooctyl-(3-propylphenyl)methyl]ethanamine (PubChem CID 116544896) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is N-[cyclooctyl-(3-propylphenyl)methyl]ethanamine.
| Compound Name | N-[cyclooctyl-(3-propylphenyl)methyl]ethanamine |
|---|---|
| PubChem CID | 116544896 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | N-[cyclooctyl-(3-propylphenyl)methyl]ethanamine |
| SMILES | CCCc1cccc(C(NCC)C2CCCCCCC2)c1 |
| InChI | InChI=1S/C20H33N/c1-3-11-17-12-10-15-19(16-17)20(21-4-2)18-13-8-6-5-7-9-14-18/h10,12,15-16,18,20-21H,3-9,11,13-14H2,1-2H3 |
| InChIKey | XIPSOWFITGYFJO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |