C24H37N3O3 — CID 11654577
1-cyclohexyl-4-[3-(5-methoxy-8-nitro-1,2,3,4-tetrahydronaphthalen-1-yl)propyl]piperazine (PubChem CID 11654577) has the molecular formula C24H37N3O3 and a molecular weight of 415.58 g/mol. Its IUPAC name is 1-cyclohexyl-4-[3-(5-methoxy-8-nitro-1,2,3,4-tetrahydronaphthalen-1-yl)propyl]piperazine.
| Compound Name | 1-cyclohexyl-4-[3-(5-methoxy-8-nitro-1,2,3,4-tetrahydronaphthalen-1-yl)propyl]piperazine |
|---|---|
| PubChem CID | 11654577 |
| Molecular Formula | C24H37N3O3 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.28 |
| IUPAC Name | 1-cyclohexyl-4-[3-(5-methoxy-8-nitro-1,2,3,4-tetrahydronaphthalen-1-yl)propyl]piperazine |
| SMILES | COc1ccc([N+](=O)[O-])c2c1CCCC2CCCN1CCN(C2CCCCC2)CC1 |
| InChI | InChI=1S/C24H37N3O3/c1-30-23-13-12-22(27(28)29)24-19(7-5-11-21(23)24)8-6-14-25-15-17-26(18-16-25)20-9-3-2-4-10-20/h12-13,19-20H,2-11,14-18H2,1H3 |
| InChIKey | ORZMIRWJXWWNPM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|