C15H17NO — CID 116546935
2-cyclopropyl-1-(1,6-dimethylindol-3-yl)ethanone (PubChem CID 116546935) has the molecular formula C15H17NO and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-cyclopropyl-1-(1,6-dimethylindol-3-yl)ethanone.
| Compound Name | 2-cyclopropyl-1-(1,6-dimethylindol-3-yl)ethanone |
|---|---|
| PubChem CID | 116546935 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-cyclopropyl-1-(1,6-dimethylindol-3-yl)ethanone |
| SMILES | Cc1ccc2c(C(=O)CC3CC3)cn(C)c2c1 |
| InChI | InChI=1S/C15H17NO/c1-10-3-6-12-13(9-16(2)14(12)7-10)15(17)8-11-4-5-11/h3,6-7,9,11H,4-5,8H2,1-2H3 |
| InChIKey | GQWGKRDJIREPMR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |