About (4-aminophenyl)-(1,6-dimethylindol-3-yl)methanone
(4-aminophenyl)-(1,6-dimethylindol-3-yl)methanone (PubChem CID 116547133) has the molecular formula C17H16N2O
and a molecular weight of 264.33 g/mol. Its IUPAC name is (4-aminophenyl)-(1,6-dimethylindol-3-yl)methanone.
Molecular Properties
| Compound Name | (4-aminophenyl)-(1,6-dimethylindol-3-yl)methanone |
| PubChem CID | 116547133 |
| Molecular Formula | C17H16N2O |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | (4-aminophenyl)-(1,6-dimethylindol-3-yl)methanone |
| SMILES | Cc1ccc2c(C(=O)c3ccc(N)cc3)cn(C)c2c1 |
| InChI | InChI=1S/C17H16N2O/c1-11-3-8-14-15(10-19(2)16(14)9-11)17(20)12-4-6-13(18)7-5-12/h3-10H,18H2,1-2H3 |
| InChIKey | QHQHDTSLKIMGCA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (4-aminophenyl)-(1,6-dimethylindol-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-aminophenyl)-(1,6-dimethylindol-3-yl)methanone?
The IUPAC name of (4-aminophenyl)-(1,6-dimethylindol-3-yl)methanone (CID 116547133) is (4-aminophenyl)-(1,6-dimethylindol-3-yl)methanone.
What is the SMILES notation for (4-aminophenyl)-(1,6-dimethylindol-3-yl)methanone?
The canonical SMILES for (4-aminophenyl)-(1,6-dimethylindol-3-yl)methanone is Cc1ccc2c(C(=O)c3ccc(N)cc3)cn(C)c2c1.
What is the InChIKey of (4-aminophenyl)-(1,6-dimethylindol-3-yl)methanone?
The InChIKey is QHQHDTSLKIMGCA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16N2O/c1-11-3-8-14-15(10-19(2)16(14)9-11)17(20)12-4-6-13(18)7-5-12/h3-10H,18H2,1-2H3.
What are the key properties of (4-aminophenyl)-(1,6-dimethylindol-3-yl)methanone?
(4-aminophenyl)-(1,6-dimethylindol-3-yl)methanone has a molecular weight of 264.33 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-aminophenyl)-(1,6-dimethylindol-3-yl)methanone is sourced from PubChem (CID 116547133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).