C23H22N2O4S — CID 11654731
7-[(2R)-1-ethylsulfonyl-5-(methoxymethoxy)-2,3-dihydroindol-2-yl]naphthalene-2-carbonitrile (PubChem CID 11654731) has the molecular formula C23H22N2O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is 7-[(2R)-1-ethylsulfonyl-5-(methoxymethoxy)-2,3-dihydroindol-2-yl]naphthalene-2-carbonitrile.
| Compound Name | 7-[(2R)-1-ethylsulfonyl-5-(methoxymethoxy)-2,3-dihydroindol-2-yl]naphthalene-2-carbonitrile |
|---|---|
| PubChem CID | 11654731 |
| Molecular Formula | C23H22N2O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | 7-[(2R)-1-ethylsulfonyl-5-(methoxymethoxy)-2,3-dihydroindol-2-yl]naphthalene-2-carbonitrile |
| SMILES | CCS(=O)(=O)N1c2ccc(OCOC)cc2C[C@@H]1c1ccc2ccc(C#N)cc2c1 |
| InChI | InChI=1S/C23H22N2O4S/c1-3-30(26,27)25-22-9-8-21(29-15-28-2)12-20(22)13-23(25)18-7-6-17-5-4-16(14-24)10-19(17)11-18/h4-12,23H,3,13,15H2,1-2H3/t23-/m1/s1 |
| InChIKey | KQAXYDRAECIRDT-HSZRJFAPSA-N |
| XLogP | 4.15 |
| TPSA | 79.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|