C22H36O6Si — CID 11654764
(1R,2R,3R,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-9-oxabicyclo[3.3.1]nonane-1,4-diol (PubChem CID 11654764) has the molecular formula C22H36O6Si and a molecular weight of 424.61 g/mol. Its IUPAC name is (1R,2R,3R,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-9-oxabicyclo[3.3.1]nonane-1,4-diol.
| Compound Name | (1R,2R,3R,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-9-oxabicyclo[3.3.1]nonane-1,4-diol |
|---|---|
| PubChem CID | 11654764 |
| Molecular Formula | C22H36O6Si |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | (1R,2R,3R,4S,5S)-2-[tert-butyl(dimethyl)silyl]oxy-3-[(4-methoxyphenyl)methoxy]-9-oxabicyclo[3.3.1]nonane-1,4-diol |
| SMILES | COc1ccc(CO[C@@H]2[C@@H](O)[C@@H]3CCC[C@@](O)(O3)[C@@H]2O[Si](C)(C)C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H36O6Si/c1-21(2,3)29(5,6)28-20-19(18(23)17-8-7-13-22(20,24)27-17)26-14-15-9-11-16(25-4)12-10-15/h9-12,17-20,23-24H,7-8,13-14H2,1-6H3/t17-,18-,19+,20+,22+/m0/s1 |
| InChIKey | VEJKOUQLYNMAJL-UDGWLPKNSA-N |
| XLogP | 3.60 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|