C13H15F2NO — CID 116547766
2-(2,5-difluorophenyl)-1-piperidin-2-ylethanone (PubChem CID 116547766) has the molecular formula C13H15F2NO and a molecular weight of 239.26 g/mol. Its IUPAC name is 2-(2,5-difluorophenyl)-1-piperidin-2-ylethanone.
| Compound Name | 2-(2,5-difluorophenyl)-1-piperidin-2-ylethanone |
|---|---|
| PubChem CID | 116547766 |
| Molecular Formula | C13H15F2NO |
| Molecular Weight | 239.26 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-(2,5-difluorophenyl)-1-piperidin-2-ylethanone |
| SMILES | O=C(Cc1cc(F)ccc1F)C1CCCCN1 |
| InChI | InChI=1S/C13H15F2NO/c14-10-4-5-11(15)9(7-10)8-13(17)12-3-1-2-6-16-12/h4-5,7,12,16H,1-3,6,8H2 |
| InChIKey | IGDQUZNRGKNJTN-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.26 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |