C20H12F3N5OS — CID 11654808
4-(pyrimidin-4-ylamino)-N-[4-(2,3,4-trifluorophenyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 11654808) has the molecular formula C20H12F3N5OS and a molecular weight of 427.41 g/mol. Its IUPAC name is 4-(pyrimidin-4-ylamino)-N-[4-(2,3,4-trifluorophenyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(pyrimidin-4-ylamino)-N-[4-(2,3,4-trifluorophenyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 11654808 |
| Molecular Formula | C20H12F3N5OS |
| Molecular Weight | 427.41 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | 4-(pyrimidin-4-ylamino)-N-[4-(2,3,4-trifluorophenyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)c(F)c2F)cs1)c1ccc(Nc2ccncn2)cc1 |
| InChI | InChI=1S/C20H12F3N5OS/c21-14-6-5-13(17(22)18(14)23)15-9-30-20(27-15)28-19(29)11-1-3-12(4-2-11)26-16-7-8-24-10-25-16/h1-10H,(H,24,25,26)(H,27,28,29) |
| InChIKey | HKRLBAXKTBQJLR-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|