C22H42O6Si — CID 11654885
(2R,3S,4S,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2Z)-3,7-dimethylocta-2,6-dienoxy]oxane-3,4,5-triol (PubChem CID 11654885) has the molecular formula C22H42O6Si and a molecular weight of 430.66 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2Z)-3,7-dimethylocta-2,6-dienoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2Z)-3,7-dimethylocta-2,6-dienoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 11654885 |
| Molecular Formula | C22H42O6Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-[(2Z)-3,7-dimethylocta-2,6-dienoxy]oxane-3,4,5-triol |
| SMILES | CC(C)=CCC/C(C)=C\CO[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C22H42O6Si/c1-15(2)10-9-11-16(3)12-13-26-21-20(25)19(24)18(23)17(28-21)14-27-29(7,8)22(4,5)6/h10,12,17-21,23-25H,9,11,13-14H2,1-8H3/b16-12-/t17-,18-,19+,20-,21-/m1/s1 |
| InChIKey | GWDYTKKMGIROMU-JUHPINOQSA-N |
| XLogP | 3.53 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|