C16H21NO — CID 116549688
cyclohexyl(1,2,3,4-tetrahydroisoquinolin-3-yl)methanone (PubChem CID 116549688) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is cyclohexyl(1,2,3,4-tetrahydroisoquinolin-3-yl)methanone.
| Compound Name | cyclohexyl(1,2,3,4-tetrahydroisoquinolin-3-yl)methanone |
|---|---|
| PubChem CID | 116549688 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | cyclohexyl(1,2,3,4-tetrahydroisoquinolin-3-yl)methanone |
| SMILES | O=C(C1CCCCC1)C1Cc2ccccc2CN1 |
| InChI | InChI=1S/C16H21NO/c18-16(12-6-2-1-3-7-12)15-10-13-8-4-5-9-14(13)11-17-15/h4-5,8-9,12,15,17H,1-3,6-7,10-11H2 |
| InChIKey | UJSLILNSQQNGBO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |