C10H17N3O3S — CID 116552034
3-amino-1-(1-methylimidazol-2-yl)-5-methylsulfonylpentan-2-one (PubChem CID 116552034) has the molecular formula C10H17N3O3S and a molecular weight of 259.33 g/mol. Its IUPAC name is 3-amino-1-(1-methylimidazol-2-yl)-5-methylsulfonylpentan-2-one.
| Compound Name | 3-amino-1-(1-methylimidazol-2-yl)-5-methylsulfonylpentan-2-one |
|---|---|
| PubChem CID | 116552034 |
| Molecular Formula | C10H17N3O3S |
| Molecular Weight | 259.33 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 3-amino-1-(1-methylimidazol-2-yl)-5-methylsulfonylpentan-2-one |
| SMILES | Cn1ccnc1CC(=O)C(N)CCS(C)(=O)=O |
| InChI | InChI=1S/C10H17N3O3S/c1-13-5-4-12-10(13)7-9(14)8(11)3-6-17(2,15)16/h4-5,8H,3,6-7,11H2,1-2H3 |
| InChIKey | GNOSNOJSWCCHCC-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 95.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.33 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |