C21H18ClFN4O4 — CID 11655210
4-[2-amino-3-chloro-4-[[(1R,2S)-2-fluorocyclopropyl]carbamoyl]phenoxy]-7-methoxyquinoline-6-carboxamide (PubChem CID 11655210) has the molecular formula C21H18ClFN4O4 and a molecular weight of 444.85 g/mol. Its IUPAC name is 4-[2-amino-3-chloro-4-[[(1R,2S)-2-fluorocyclopropyl]carbamoyl]phenoxy]-7-methoxyquinoline-6-carboxamide.
| Compound Name | 4-[2-amino-3-chloro-4-[[(1R,2S)-2-fluorocyclopropyl]carbamoyl]phenoxy]-7-methoxyquinoline-6-carboxamide |
|---|---|
| PubChem CID | 11655210 |
| Molecular Formula | C21H18ClFN4O4 |
| Molecular Weight | 444.85 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | 4-[2-amino-3-chloro-4-[[(1R,2S)-2-fluorocyclopropyl]carbamoyl]phenoxy]-7-methoxyquinoline-6-carboxamide |
| SMILES | COc1cc2nccc(Oc3ccc(C(=O)N[C@@H]4C[C@@H]4F)c(Cl)c3N)c2cc1C(N)=O |
| InChI | InChI=1S/C21H18ClFN4O4/c1-30-17-8-13-10(6-11(17)20(25)28)15(4-5-26-13)31-16-3-2-9(18(22)19(16)24)21(29)27-14-7-12(14)23/h2-6,8,12,14H,7,24H2,1H3,(H2,25,28)(H,27,29)/t12-,14+/m0/s1 |
| InChIKey | ALQHNZLBHJUYOL-GXTWGEPZSA-N |
| XLogP | 3.21 |
| TPSA | 129.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.85 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|