About 4-(pyrimidin-4-ylamino)-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]benzamide
4-(pyrimidin-4-ylamino)-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 11655467) has the molecular formula C21H14F3N5O2S
and a molecular weight of 457.44 g/mol. Its IUPAC name is 4-(pyrimidin-4-ylamino)-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]benzamide.
Molecular Properties
| Compound Name | 4-(pyrimidin-4-ylamino)-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]benzamide |
| PubChem CID | 11655467 |
| Molecular Formula | C21H14F3N5O2S |
| Molecular Weight | 457.44 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | 4-(pyrimidin-4-ylamino)-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | O=C(Nc1nc(-c2ccc(OC(F)(F)F)cc2)cs1)c1ccc(Nc2ccncn2)cc1 |
| InChI | InChI=1S/C21H14F3N5O2S/c22-21(23,24)31-16-7-3-13(4-8-16)17-11-32-20(28-17)29-19(30)14-1-5-15(6-2-14)27-18-9-10-25-12-26-18/h1-12H,(H,25,26,27)(H,28,29,30) |
| InChIKey | JJOCOXBSLIWSNT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 457.44 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(pyrimidin-4-ylamino)-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(pyrimidin-4-ylamino)-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]benzamide?
The IUPAC name of 4-(pyrimidin-4-ylamino)-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]benzamide (CID 11655467) is 4-(pyrimidin-4-ylamino)-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]benzamide.
What is the SMILES notation for 4-(pyrimidin-4-ylamino)-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]benzamide?
The canonical SMILES for 4-(pyrimidin-4-ylamino)-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]benzamide is O=C(Nc1nc(-c2ccc(OC(F)(F)F)cc2)cs1)c1ccc(Nc2ccncn2)cc1.
What is the InChIKey of 4-(pyrimidin-4-ylamino)-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]benzamide?
The InChIKey is JJOCOXBSLIWSNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14F3N5O2S/c22-21(23,24)31-16-7-3-13(4-8-16)17-11-32-20(28-17)29-19(30)14-1-5-15(6-2-14)27-18-9-10-25-12-26-18/h1-12H,(H,25,26,27)(H,28,29,30).
What are the key properties of 4-(pyrimidin-4-ylamino)-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]benzamide?
4-(pyrimidin-4-ylamino)-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]benzamide has a molecular weight of 457.44 g/mol, XLogP of 5.49, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(pyrimidin-4-ylamino)-N-[4-[4-(trifluoromethoxy)phenyl]-1,3-thiazol-2-yl]benzamide is sourced from PubChem (CID 11655467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).