C20H23IN4O — CID 11655570
8-iodo-2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6-methylimidazo[1,2-a]pyridine (PubChem CID 11655570) has the molecular formula C20H23IN4O and a molecular weight of 462.34 g/mol. Its IUPAC name is 8-iodo-2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6-methylimidazo[1,2-a]pyridine.
| Compound Name | 8-iodo-2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6-methylimidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 11655570 |
| Molecular Formula | C20H23IN4O |
| Molecular Weight | 462.34 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 8-iodo-2-[[4-(2-methoxyphenyl)piperazin-1-yl]methyl]-6-methylimidazo[1,2-a]pyridine |
| SMILES | COc1ccccc1N1CCN(Cc2cn3cc(C)cc(I)c3n2)CC1 |
| InChI | InChI=1S/C20H23IN4O/c1-15-11-17(21)20-22-16(14-25(20)12-15)13-23-7-9-24(10-8-23)18-5-3-4-6-19(18)26-2/h3-6,11-12,14H,7-10,13H2,1-2H3 |
| InChIKey | KESPBTDDQDBERC-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 33.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|