C22H20INOS — CID 11655825
(3S)-8-cyclopropyl-3-(iodomethyl)-7-(naphthalen-1-ylmethyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridin-5-one (PubChem CID 11655825) has the molecular formula C22H20INOS and a molecular weight of 473.38 g/mol. Its IUPAC name is (3S)-8-cyclopropyl-3-(iodomethyl)-7-(naphthalen-1-ylmethyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridin-5-one.
| Compound Name | (3S)-8-cyclopropyl-3-(iodomethyl)-7-(naphthalen-1-ylmethyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridin-5-one |
|---|---|
| PubChem CID | 11655825 |
| Molecular Formula | C22H20INOS |
| Molecular Weight | 473.38 g/mol |
| Exact Mass | 473.03 |
| IUPAC Name | (3S)-8-cyclopropyl-3-(iodomethyl)-7-(naphthalen-1-ylmethyl)-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridin-5-one |
| SMILES | O=c1cc(Cc2cccc3ccccc23)c(C2CC2)c2n1[C@H](CI)CS2 |
| InChI | InChI=1S/C22H20INOS/c23-12-18-13-26-22-21(15-8-9-15)17(11-20(25)24(18)22)10-16-6-3-5-14-4-1-2-7-19(14)16/h1-7,11,15,18H,8-10,12-13H2/t18-/m1/s1 |
| InChIKey | IQVBHICTRVQCMF-GOSISDBHSA-N |
| XLogP | 5.55 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.38 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|