About 1-(cyclopentylamino)-6,6,6-trifluorohexan-2-one
1-(cyclopentylamino)-6,6,6-trifluorohexan-2-one (PubChem CID 116559112) has the molecular formula C11H18F3NO
and a molecular weight of 237.26 g/mol. Its IUPAC name is 1-(cyclopentylamino)-6,6,6-trifluorohexan-2-one.
Molecular Properties
| Compound Name | 1-(cyclopentylamino)-6,6,6-trifluorohexan-2-one |
| PubChem CID | 116559112 |
| Molecular Formula | C11H18F3NO |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 1-(cyclopentylamino)-6,6,6-trifluorohexan-2-one |
| SMILES | O=C(CCCC(F)(F)F)CNC1CCCC1 |
| InChI | InChI=1S/C11H18F3NO/c12-11(13,14)7-3-6-10(16)8-15-9-4-1-2-5-9/h9,15H,1-8H2 |
| InChIKey | BXWZRCPMBAHBCH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(cyclopentylamino)-6,6,6-trifluorohexan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopentylamino)-6,6,6-trifluorohexan-2-one?
The IUPAC name of 1-(cyclopentylamino)-6,6,6-trifluorohexan-2-one (CID 116559112) is 1-(cyclopentylamino)-6,6,6-trifluorohexan-2-one.
What is the SMILES notation for 1-(cyclopentylamino)-6,6,6-trifluorohexan-2-one?
The canonical SMILES for 1-(cyclopentylamino)-6,6,6-trifluorohexan-2-one is O=C(CCCC(F)(F)F)CNC1CCCC1.
What is the InChIKey of 1-(cyclopentylamino)-6,6,6-trifluorohexan-2-one?
The InChIKey is BXWZRCPMBAHBCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F3NO/c12-11(13,14)7-3-6-10(16)8-15-9-4-1-2-5-9/h9,15H,1-8H2.
What are the key properties of 1-(cyclopentylamino)-6,6,6-trifluorohexan-2-one?
1-(cyclopentylamino)-6,6,6-trifluorohexan-2-one has a molecular weight of 237.26 g/mol, XLogP of 2.82, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopentylamino)-6,6,6-trifluorohexan-2-one is sourced from PubChem (CID 116559112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).