About 1-(cyclopropylamino)-7,7,7-trifluoroheptan-3-one
1-(cyclopropylamino)-7,7,7-trifluoroheptan-3-one (PubChem CID 116559374) has the molecular formula C10H16F3NO
and a molecular weight of 223.24 g/mol. Its IUPAC name is 1-(cyclopropylamino)-7,7,7-trifluoroheptan-3-one.
Molecular Properties
| Compound Name | 1-(cyclopropylamino)-7,7,7-trifluoroheptan-3-one |
| PubChem CID | 116559374 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 1-(cyclopropylamino)-7,7,7-trifluoroheptan-3-one |
| SMILES | O=C(CCCC(F)(F)F)CCNC1CC1 |
| InChI | InChI=1S/C10H16F3NO/c11-10(12,13)6-1-2-9(15)5-7-14-8-3-4-8/h8,14H,1-7H2 |
| InChIKey | QEIYJYWRNJCZOH-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(cyclopropylamino)-7,7,7-trifluoroheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(cyclopropylamino)-7,7,7-trifluoroheptan-3-one?
The IUPAC name of 1-(cyclopropylamino)-7,7,7-trifluoroheptan-3-one (CID 116559374) is 1-(cyclopropylamino)-7,7,7-trifluoroheptan-3-one.
What is the SMILES notation for 1-(cyclopropylamino)-7,7,7-trifluoroheptan-3-one?
The canonical SMILES for 1-(cyclopropylamino)-7,7,7-trifluoroheptan-3-one is O=C(CCCC(F)(F)F)CCNC1CC1.
What is the InChIKey of 1-(cyclopropylamino)-7,7,7-trifluoroheptan-3-one?
The InChIKey is QEIYJYWRNJCZOH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO/c11-10(12,13)6-1-2-9(15)5-7-14-8-3-4-8/h8,14H,1-7H2.
What are the key properties of 1-(cyclopropylamino)-7,7,7-trifluoroheptan-3-one?
1-(cyclopropylamino)-7,7,7-trifluoroheptan-3-one has a molecular weight of 223.24 g/mol, XLogP of 2.43, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(cyclopropylamino)-7,7,7-trifluoroheptan-3-one is sourced from PubChem (CID 116559374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).