C28H41N7O — CID 11656138
2-[4-(dipropylamino)butyl]-N,N-bis(1H-imidazol-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-6-carboxamide (PubChem CID 11656138) has the molecular formula C28H41N7O and a molecular weight of 491.68 g/mol. Its IUPAC name is 2-[4-(dipropylamino)butyl]-N,N-bis(1H-imidazol-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-6-carboxamide.
| Compound Name | 2-[4-(dipropylamino)butyl]-N,N-bis(1H-imidazol-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 11656138 |
| Molecular Formula | C28H41N7O |
| Molecular Weight | 491.68 g/mol |
| Exact Mass | 491.34 |
| IUPAC Name | 2-[4-(dipropylamino)butyl]-N,N-bis(1H-imidazol-2-ylmethyl)-3,4-dihydro-1H-isoquinoline-6-carboxamide |
| SMILES | CCCN(CCC)CCCCN1CCc2cc(C(=O)N(Cc3ncc[nH]3)Cc3ncc[nH]3)ccc2C1 |
| InChI | InChI=1S/C28H41N7O/c1-3-14-33(15-4-2)16-5-6-17-34-18-9-23-19-24(7-8-25(23)20-34)28(36)35(21-26-29-10-11-30-26)22-27-31-12-13-32-27/h7-8,10-13,19H,3-6,9,14-18,20-22H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | DTVTXCUEGKCZCZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.68 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|