C19H24ClNO12 — CID 11656168
[(2R)-2-acetyloxy-2-[(5S,7R,8R,9R)-7,8-diacetyloxy-3-(2-chloroethyl)-2,4-dioxo-1,10-dioxa-3-azaspiro[4.5]decan-9-yl]ethyl] acetate (PubChem CID 11656168) has the molecular formula C19H24ClNO12 and a molecular weight of 493.85 g/mol. Its IUPAC name is [(2R)-2-acetyloxy-2-[(5S,7R,8R,9R)-7,8-diacetyloxy-3-(2-chloroethyl)-2,4-dioxo-1,10-dioxa-3-azaspiro[4.5]decan-9-yl]ethyl] acetate.
| Compound Name | [(2R)-2-acetyloxy-2-[(5S,7R,8R,9R)-7,8-diacetyloxy-3-(2-chloroethyl)-2,4-dioxo-1,10-dioxa-3-azaspiro[4.5]decan-9-yl]ethyl] acetate |
|---|---|
| PubChem CID | 11656168 |
| Molecular Formula | C19H24ClNO12 |
| Molecular Weight | 493.85 g/mol |
| Exact Mass | 493.10 |
| IUPAC Name | [(2R)-2-acetyloxy-2-[(5S,7R,8R,9R)-7,8-diacetyloxy-3-(2-chloroethyl)-2,4-dioxo-1,10-dioxa-3-azaspiro[4.5]decan-9-yl]ethyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H]1O[C@@]2(C[C@@H](OC(C)=O)[C@H]1OC(C)=O)OC(=O)N(CCCl)C2=O |
| InChI | InChI=1S/C19H24ClNO12/c1-9(22)28-8-14(30-11(3)24)16-15(31-12(4)25)13(29-10(2)23)7-19(32-16)17(26)21(6-5-20)18(27)33-19/h13-16H,5-8H2,1-4H3/t13-,14-,15-,16-,19+/m1/s1 |
| InChIKey | GJEDAVCJYOGWFD-HLTONANMSA-N |
| XLogP | 0.05 |
| TPSA | 161.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.85 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|