C11H13N3O2S — CID 116561830
2-imidazo[2,1-b][1,3]thiazol-6-yl-1-morpholin-2-ylethanone (PubChem CID 116561830) has the molecular formula C11H13N3O2S and a molecular weight of 251.31 g/mol. Its IUPAC name is 2-imidazo[2,1-b][1,3]thiazol-6-yl-1-morpholin-2-ylethanone.
| Compound Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-1-morpholin-2-ylethanone |
|---|---|
| PubChem CID | 116561830 |
| Molecular Formula | C11H13N3O2S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 2-imidazo[2,1-b][1,3]thiazol-6-yl-1-morpholin-2-ylethanone |
| SMILES | O=C(Cc1cn2ccsc2n1)C1CNCCO1 |
| InChI | InChI=1S/C11H13N3O2S/c15-9(10-6-12-1-3-16-10)5-8-7-14-2-4-17-11(14)13-8/h2,4,7,10,12H,1,3,5-6H2 |
| InChIKey | OLCIYGOYUIYWGA-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |