C28H35NO7 — CID 11656222
(2R,4S,5R,6R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptane-1,3-dione (PubChem CID 11656222) has the molecular formula C28H35NO7 and a molecular weight of 497.59 g/mol. Its IUPAC name is (2R,4S,5R,6R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptane-1,3-dione.
| Compound Name | (2R,4S,5R,6R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptane-1,3-dione |
|---|---|
| PubChem CID | 11656222 |
| Molecular Formula | C28H35NO7 |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.24 |
| IUPAC Name | (2R,4S,5R,6R)-1-[(4R)-4-benzyl-2-oxo-1,3-oxazolidin-3-yl]-5-hydroxy-7-[(4-methoxyphenyl)methoxy]-2,4,6-trimethylheptane-1,3-dione |
| SMILES | COc1ccc(COC[C@@H](C)[C@@H](O)[C@H](C)C(=O)[C@@H](C)C(=O)N2C(=O)OC[C@H]2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C28H35NO7/c1-18(15-35-16-22-10-12-24(34-4)13-11-22)25(30)19(2)26(31)20(3)27(32)29-23(17-36-28(29)33)14-21-8-6-5-7-9-21/h5-13,18-20,23,25,30H,14-17H2,1-4H3/t18-,19+,20-,23-,25-/m1/s1 |
| InChIKey | BITWMKXXPCIGDF-MAMHGHJKSA-N |
| XLogP | 3.64 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|