C25H29N7O3S — CID 11656374
formic acid;5-methyl-3-[3-[2-[[4-methyl-5-(5-methylpyrazin-2-yl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,2-oxazole (PubChem CID 11656374) has the molecular formula C25H29N7O3S and a molecular weight of 507.62 g/mol. Its IUPAC name is formic acid;5-methyl-3-[3-[2-[[4-methyl-5-(5-methylpyrazin-2-yl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,2-oxazole.
| Compound Name | formic acid;5-methyl-3-[3-[2-[[4-methyl-5-(5-methylpyrazin-2-yl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,2-oxazole |
|---|---|
| PubChem CID | 11656374 |
| Molecular Formula | C25H29N7O3S |
| Molecular Weight | 507.62 g/mol |
| Exact Mass | 507.21 |
| IUPAC Name | formic acid;5-methyl-3-[3-[2-[[4-methyl-5-(5-methylpyrazin-2-yl)-1,2,4-triazol-3-yl]sulfanyl]ethyl]-1,2,4,5-tetrahydro-3-benzazepin-7-yl]-1,2-oxazole |
| SMILES | Cc1cnc(-c2nnc(SCCN3CCc4ccc(-c5cc(C)on5)cc4CC3)n2C)cn1.O=CO |
| InChI | InChI=1S/C24H27N7OS.CH2O2/c1-16-14-26-22(15-25-16)23-27-28-24(30(23)3)33-11-10-31-8-6-18-4-5-20(13-19(18)7-9-31)21-12-17(2)32-29-21;2-1-3/h4-5,12-15H,6-11H2,1-3H3;1H,(H,2,3) |
| InChIKey | WUFIYGGYHBTLJY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 123.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.62 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|