C25H21N3O7S — CID 1165641
N-benzyl-4-nitro-N-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]benzenesulfonamide (PubChem CID 1165641) has the molecular formula C25H21N3O7S and a molecular weight of 507.52 g/mol. Its IUPAC name is N-benzyl-4-nitro-N-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]benzenesulfonamide.
| Compound Name | N-benzyl-4-nitro-N-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1165641 |
| Molecular Formula | C25H21N3O7S |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.11 |
| IUPAC Name | N-benzyl-4-nitro-N-[(7-oxo-3,6-dihydro-2H-[1,4]dioxino[2,3-g]quinolin-8-yl)methyl]benzenesulfonamide |
| SMILES | O=c1[nH]c2cc3c(cc2cc1CN(Cc1ccccc1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1)OCCO3 |
| InChI | InChI=1S/C25H21N3O7S/c29-25-19(12-18-13-23-24(14-22(18)26-25)35-11-10-34-23)16-27(15-17-4-2-1-3-5-17)36(32,33)21-8-6-20(7-9-21)28(30)31/h1-9,12-14H,10-11,15-16H2,(H,26,29) |
| InChIKey | RRQBKFRBXSGSAU-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 131.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|