C32H35N5O2 — CID 11656560
N-(3-imidazol-1-ylpropyl)-3-phenyl-2-[4-(2-piperidin-1-ylethoxy)phenyl]furo[2,3-b]pyridin-4-amine (PubChem CID 11656560) has the molecular formula C32H35N5O2 and a molecular weight of 521.67 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-3-phenyl-2-[4-(2-piperidin-1-ylethoxy)phenyl]furo[2,3-b]pyridin-4-amine.
| Compound Name | N-(3-imidazol-1-ylpropyl)-3-phenyl-2-[4-(2-piperidin-1-ylethoxy)phenyl]furo[2,3-b]pyridin-4-amine |
|---|---|
| PubChem CID | 11656560 |
| Molecular Formula | C32H35N5O2 |
| Molecular Weight | 521.67 g/mol |
| Exact Mass | 521.28 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-3-phenyl-2-[4-(2-piperidin-1-ylethoxy)phenyl]furo[2,3-b]pyridin-4-amine |
| SMILES | c1ccc(-c2c(-c3ccc(OCCN4CCCCC4)cc3)oc3nccc(NCCCn4ccnc4)c23)cc1 |
| InChI | InChI=1S/C32H35N5O2/c1-3-8-25(9-4-1)29-30-28(34-15-7-20-37-21-17-33-24-37)14-16-35-32(30)39-31(29)26-10-12-27(13-11-26)38-23-22-36-18-5-2-6-19-36/h1,3-4,8-14,16-17,21,24H,2,5-7,15,18-20,22-23H2,(H,34,35) |
| InChIKey | JZVXAFREQFUEDW-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 68.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.67 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|