C12H16BrNOS — CID 116568008
(3-bromothiophen-2-yl)-(4-ethylpiperidin-4-yl)methanone (PubChem CID 116568008) has the molecular formula C12H16BrNOS and a molecular weight of 302.24 g/mol. Its IUPAC name is (3-bromothiophen-2-yl)-(4-ethylpiperidin-4-yl)methanone.
| Compound Name | (3-bromothiophen-2-yl)-(4-ethylpiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 116568008 |
| Molecular Formula | C12H16BrNOS |
| Molecular Weight | 302.24 g/mol |
| Exact Mass | 301.01 |
| IUPAC Name | (3-bromothiophen-2-yl)-(4-ethylpiperidin-4-yl)methanone |
| SMILES | CCC1(C(=O)c2sccc2Br)CCNCC1 |
| InChI | InChI=1S/C12H16BrNOS/c1-2-12(4-6-14-7-5-12)11(15)10-9(13)3-8-16-10/h3,8,14H,2,4-7H2,1H3 |
| InChIKey | PCITVQHLMIMCPM-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.24 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |