C24H21F6N3O3S — CID 11656811
(5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-piperazin-1-yl-1,3-thiazol-4-one (PubChem CID 11656811) has the molecular formula C24H21F6N3O3S and a molecular weight of 545.51 g/mol. Its IUPAC name is (5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-piperazin-1-yl-1,3-thiazol-4-one.
| Compound Name | (5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-piperazin-1-yl-1,3-thiazol-4-one |
|---|---|
| PubChem CID | 11656811 |
| Molecular Formula | C24H21F6N3O3S |
| Molecular Weight | 545.51 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | (5E)-5-[[4-[[2,4-bis(trifluoromethyl)phenyl]methoxy]-3-methoxyphenyl]methylidene]-2-piperazin-1-yl-1,3-thiazol-4-one |
| SMILES | COc1cc(/C=C2/SC(N3CCNCC3)=NC2=O)ccc1OCc1ccc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/C24H21F6N3O3S/c1-35-19-10-14(11-20-21(34)32-22(37-20)33-8-6-31-7-9-33)2-5-18(19)36-13-15-3-4-16(23(25,26)27)12-17(15)24(28,29)30/h2-5,10-12,31H,6-9,13H2,1H3/b20-11+ |
| InChIKey | AMSTZDLCJWCZMU-RGVLZGJSSA-N |
| XLogP | 5.19 |
| TPSA | 63.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.51 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_B(90)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|