C12H14FNO2 — CID 116568282
(3-fluoro-4-methoxyphenyl)-pyrrolidin-3-ylmethanone (PubChem CID 116568282) has the molecular formula C12H14FNO2 and a molecular weight of 223.25 g/mol. Its IUPAC name is (3-fluoro-4-methoxyphenyl)-pyrrolidin-3-ylmethanone.
| Compound Name | (3-fluoro-4-methoxyphenyl)-pyrrolidin-3-ylmethanone |
|---|---|
| PubChem CID | 116568282 |
| Molecular Formula | C12H14FNO2 |
| Molecular Weight | 223.25 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | (3-fluoro-4-methoxyphenyl)-pyrrolidin-3-ylmethanone |
| SMILES | COc1ccc(C(=O)C2CCNC2)cc1F |
| InChI | InChI=1S/C12H14FNO2/c1-16-11-3-2-8(6-10(11)13)12(15)9-4-5-14-7-9/h2-3,6,9,14H,4-5,7H2,1H3 |
| InChIKey | JLRLHOWCPYCXEO-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |