C12H20F3NO — CID 116568647
1-(3-ethylpiperidin-3-yl)-5,5,5-trifluoropentan-1-one (PubChem CID 116568647) has the molecular formula C12H20F3NO and a molecular weight of 251.29 g/mol. Its IUPAC name is 1-(3-ethylpiperidin-3-yl)-5,5,5-trifluoropentan-1-one.
| Compound Name | 1-(3-ethylpiperidin-3-yl)-5,5,5-trifluoropentan-1-one |
|---|---|
| PubChem CID | 116568647 |
| Molecular Formula | C12H20F3NO |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 1-(3-ethylpiperidin-3-yl)-5,5,5-trifluoropentan-1-one |
| SMILES | CCC1(C(=O)CCCC(F)(F)F)CCCNC1 |
| InChI | InChI=1S/C12H20F3NO/c1-2-11(6-4-8-16-9-11)10(17)5-3-7-12(13,14)15/h16H,2-9H2,1H3 |
| InChIKey | UFQCESISEAOWIZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |