C11H18F3NO — CID 116569494
5,5,5-trifluoro-1-(3-methylpiperidin-3-yl)pentan-1-one (PubChem CID 116569494) has the molecular formula C11H18F3NO and a molecular weight of 237.26 g/mol. Its IUPAC name is 5,5,5-trifluoro-1-(3-methylpiperidin-3-yl)pentan-1-one.
| Compound Name | 5,5,5-trifluoro-1-(3-methylpiperidin-3-yl)pentan-1-one |
|---|---|
| PubChem CID | 116569494 |
| Molecular Formula | C11H18F3NO |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 5,5,5-trifluoro-1-(3-methylpiperidin-3-yl)pentan-1-one |
| SMILES | CC1(C(=O)CCCC(F)(F)F)CCCNC1 |
| InChI | InChI=1S/C11H18F3NO/c1-10(5-3-7-15-8-10)9(16)4-2-6-11(12,13)14/h15H,2-8H2,1H3 |
| InChIKey | KCDGDRMNBGWGKG-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |