About 1-(3-methylpyrrolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone
1-(3-methylpyrrolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone (PubChem CID 116570016) has the molecular formula C10H14N2OS
and a molecular weight of 210.30 g/mol. Its IUPAC name is 1-(3-methylpyrrolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3-methylpyrrolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone |
| PubChem CID | 116570016 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-(3-methylpyrrolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone |
| SMILES | CC1(C(=O)Cc2cncs2)CCNC1 |
| InChI | InChI=1S/C10H14N2OS/c1-10(2-3-11-6-10)9(13)4-8-5-12-7-14-8/h5,7,11H,2-4,6H2,1H3 |
| InChIKey | FGCJMQKDLZTWLX-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-(3-methylpyrrolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylpyrrolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone?
The IUPAC name of 1-(3-methylpyrrolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone (CID 116570016) is 1-(3-methylpyrrolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone.
What is the SMILES notation for 1-(3-methylpyrrolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone?
The canonical SMILES for 1-(3-methylpyrrolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone is CC1(C(=O)Cc2cncs2)CCNC1.
What is the InChIKey of 1-(3-methylpyrrolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone?
The InChIKey is FGCJMQKDLZTWLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2OS/c1-10(2-3-11-6-10)9(13)4-8-5-12-7-14-8/h5,7,11H,2-4,6H2,1H3.
What are the key properties of 1-(3-methylpyrrolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone?
1-(3-methylpyrrolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone has a molecular weight of 210.30 g/mol, XLogP of 1.25, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylpyrrolidin-3-yl)-2-(1,3-thiazol-5-yl)ethanone is sourced from PubChem (CID 116570016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).