C28H43N5O6S — CID 11657112
3-[3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]propanoylamino]propyl-diethyl-methylazanium;methyl sulfate (PubChem CID 11657112) has the molecular formula C28H43N5O6S and a molecular weight of 577.75 g/mol. Its IUPAC name is 3-[3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]propanoylamino]propyl-diethyl-methylazanium;methyl sulfate.
| Compound Name | 3-[3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]propanoylamino]propyl-diethyl-methylazanium;methyl sulfate |
|---|---|
| PubChem CID | 11657112 |
| Molecular Formula | C28H43N5O6S |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.29 |
| IUPAC Name | 3-[3-[3-(benzotriazol-2-yl)-5-tert-butyl-4-hydroxyphenyl]propanoylamino]propyl-diethyl-methylazanium;methyl sulfate |
| SMILES | CC[N+](C)(CC)CCCNC(=O)CCc1cc(-n2nc3ccccc3n2)c(O)c(C(C)(C)C)c1.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C27H39N5O2.CH4O4S/c1-7-32(6,8-2)17-11-16-28-25(33)15-14-20-18-21(27(3,4)5)26(34)24(19-20)31-29-22-12-9-10-13-23(22)30-31;1-5-6(2,3)4/h9-10,12-13,18-19H,7-8,11,14-17H2,1-6H3,(H-,28,33,34);1H3,(H,2,3,4) |
| InChIKey | ALMZVQVAXMNRQF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 146.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|