C11H17NO2 — CID 116573777
3-amino-1-(furan-3-yl)-2,2,3-trimethylbutan-1-one (PubChem CID 116573777) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is 3-amino-1-(furan-3-yl)-2,2,3-trimethylbutan-1-one.
| Compound Name | 3-amino-1-(furan-3-yl)-2,2,3-trimethylbutan-1-one |
|---|---|
| PubChem CID | 116573777 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | 3-amino-1-(furan-3-yl)-2,2,3-trimethylbutan-1-one |
| SMILES | CC(C)(N)C(C)(C)C(=O)c1ccoc1 |
| InChI | InChI=1S/C11H17NO2/c1-10(2,11(3,4)12)9(13)8-5-6-14-7-8/h5-7H,12H2,1-4H3 |
| InChIKey | AMQULOXRYBGELA-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |