About 9-amino-1,1,1-trifluoro-5-methyldecan-4-one
9-amino-1,1,1-trifluoro-5-methyldecan-4-one (PubChem CID 116574348) has the molecular formula C11H20F3NO
and a molecular weight of 239.28 g/mol. Its IUPAC name is 9-amino-1,1,1-trifluoro-5-methyldecan-4-one.
Molecular Properties
| Compound Name | 9-amino-1,1,1-trifluoro-5-methyldecan-4-one |
| PubChem CID | 116574348 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 9-amino-1,1,1-trifluoro-5-methyldecan-4-one |
| SMILES | CC(N)CCCC(C)C(=O)CCC(F)(F)F |
| InChI | InChI=1S/C11H20F3NO/c1-8(4-3-5-9(2)15)10(16)6-7-11(12,13)14/h8-9H,3-7,15H2,1-2H3 |
| InChIKey | GNOCQPVRXGBZGC-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-amino-1,1,1-trifluoro-5-methyldecan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-1,1,1-trifluoro-5-methyldecan-4-one?
The IUPAC name of 9-amino-1,1,1-trifluoro-5-methyldecan-4-one (CID 116574348) is 9-amino-1,1,1-trifluoro-5-methyldecan-4-one.
What is the SMILES notation for 9-amino-1,1,1-trifluoro-5-methyldecan-4-one?
The canonical SMILES for 9-amino-1,1,1-trifluoro-5-methyldecan-4-one is CC(N)CCCC(C)C(=O)CCC(F)(F)F.
What is the InChIKey of 9-amino-1,1,1-trifluoro-5-methyldecan-4-one?
The InChIKey is GNOCQPVRXGBZGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3NO/c1-8(4-3-5-9(2)15)10(16)6-7-11(12,13)14/h8-9H,3-7,15H2,1-2H3.
What are the key properties of 9-amino-1,1,1-trifluoro-5-methyldecan-4-one?
9-amino-1,1,1-trifluoro-5-methyldecan-4-one has a molecular weight of 239.28 g/mol, XLogP of 3.05, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-1,1,1-trifluoro-5-methyldecan-4-one is sourced from PubChem (CID 116574348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).