About 9-amino-2,5-dimethyldec-2-en-4-one
9-amino-2,5-dimethyldec-2-en-4-one (PubChem CID 116574382) has the molecular formula C12H23NO
and a molecular weight of 197.32 g/mol. Its IUPAC name is 9-amino-2,5-dimethyldec-2-en-4-one.
Molecular Properties
| Compound Name | 9-amino-2,5-dimethyldec-2-en-4-one |
| PubChem CID | 116574382 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 9-amino-2,5-dimethyldec-2-en-4-one |
| SMILES | CC(C)=CC(=O)C(C)CCCC(C)N |
| InChI | InChI=1S/C12H23NO/c1-9(2)8-12(14)10(3)6-5-7-11(4)13/h8,10-11H,5-7,13H2,1-4H3 |
| InChIKey | GYYZFRJYXDWTFB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 9-amino-2,5-dimethyldec-2-en-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-2,5-dimethyldec-2-en-4-one?
The IUPAC name of 9-amino-2,5-dimethyldec-2-en-4-one (CID 116574382) is 9-amino-2,5-dimethyldec-2-en-4-one.
What is the SMILES notation for 9-amino-2,5-dimethyldec-2-en-4-one?
The canonical SMILES for 9-amino-2,5-dimethyldec-2-en-4-one is CC(C)=CC(=O)C(C)CCCC(C)N.
What is the InChIKey of 9-amino-2,5-dimethyldec-2-en-4-one?
The InChIKey is GYYZFRJYXDWTFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO/c1-9(2)8-12(14)10(3)6-5-7-11(4)13/h8,10-11H,5-7,13H2,1-4H3.
What are the key properties of 9-amino-2,5-dimethyldec-2-en-4-one?
9-amino-2,5-dimethyldec-2-en-4-one has a molecular weight of 197.32 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-2,5-dimethyldec-2-en-4-one is sourced from PubChem (CID 116574382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).