C37H68O6Si2 — CID 11657594
2-[(1R,2S,3R,4R,7R,8R,10E,14R)-4-hydroxy-6,14-dimethyl-14-triethylsilyloxy-10-[tri(propan-2-yl)silyloxymethyl]-15-oxatricyclo[6.6.1.02,7]pentadeca-5,10-dien-3-yl]propan-2-yl acetate (PubChem CID 11657594) has the molecular formula C37H68O6Si2 and a molecular weight of 665.12 g/mol. Its IUPAC name is 2-[(1R,2S,3R,4R,7R,8R,10E,14R)-4-hydroxy-6,14-dimethyl-14-triethylsilyloxy-10-[tri(propan-2-yl)silyloxymethyl]-15-oxatricyclo[6.6.1.02,7]pentadeca-5,10-dien-3-yl]propan-2-yl acetate.
| Compound Name | 2-[(1R,2S,3R,4R,7R,8R,10E,14R)-4-hydroxy-6,14-dimethyl-14-triethylsilyloxy-10-[tri(propan-2-yl)silyloxymethyl]-15-oxatricyclo[6.6.1.02,7]pentadeca-5,10-dien-3-yl]propan-2-yl acetate |
|---|---|
| PubChem CID | 11657594 |
| Molecular Formula | C37H68O6Si2 |
| Molecular Weight | 665.12 g/mol |
| Exact Mass | 664.46 |
| IUPAC Name | 2-[(1R,2S,3R,4R,7R,8R,10E,14R)-4-hydroxy-6,14-dimethyl-14-triethylsilyloxy-10-[tri(propan-2-yl)silyloxymethyl]-15-oxatricyclo[6.6.1.02,7]pentadeca-5,10-dien-3-yl]propan-2-yl acetate |
| SMILES | CC[Si](CC)(CC)O[C@]1(C)CC/C=C(/CO[Si](C(C)C)(C(C)C)C(C)C)C[C@H]2O[C@@H]1[C@H]1[C@@H]2C(C)=C[C@@H](O)[C@@H]1C(C)(C)OC(C)=O |
| InChI | InChI=1S/C37H68O6Si2/c1-15-44(16-2,17-3)43-37(14)20-18-19-29(23-40-45(24(4)5,25(6)7)26(8)9)22-31-32-27(10)21-30(39)34(33(32)35(37)41-31)36(12,13)42-28(11)38/h19,21,24-26,30-35,39H,15-18,20,22-23H2,1-14H3/b29-19+/t30-,31-,32-,33+,34+,35-,37-/m1/s1 |
| InChIKey | VMEMBJALOVSRHG-YBFOFPRQSA-N |
| XLogP | 9.35 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.12 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|