C44H84N2O6 — CID 11657776
2,2-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl)decanedioic acid (PubChem CID 11657776) has the molecular formula C44H84N2O6 and a molecular weight of 737.16 g/mol. Its IUPAC name is 2,2-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl)decanedioic acid.
| Compound Name | 2,2-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl)decanedioic acid |
|---|---|
| PubChem CID | 11657776 |
| Molecular Formula | C44H84N2O6 |
| Molecular Weight | 737.16 g/mol |
| Exact Mass | 736.63 |
| IUPAC Name | 2,2-bis(2,2,6,6-tetramethyl-1-octoxypiperidin-3-yl)decanedioic acid |
| SMILES | CCCCCCCCON1C(C)(C)CCC(C(CCCCCCCC(=O)O)(C(=O)O)C2CCC(C)(C)N(OCCCCCCCC)C2(C)C)C1(C)C |
| InChI | InChI=1S/C44H84N2O6/c1-11-13-15-17-22-26-34-51-45-40(3,4)32-29-36(42(45,7)8)44(39(49)50,31-25-21-19-20-24-28-38(47)48)37-30-33-41(5,6)46(43(37,9)10)52-35-27-23-18-16-14-12-2/h36-37H,11-35H2,1-10H3,(H,47,48)(H,49,50) |
| InChIKey | DCOZBPTXZNTCFM-UHFFFAOYSA-N |
| XLogP | 12.00 |
| TPSA | 99.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.16 |
| LogP ≤ 5 | 12.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|