C42H66O9Si — CID 11657784
(2S,3S,4R,7S,9S,11S)-9-acetyloxy-3,11-bis[(4-methoxyphenyl)methoxy]-2,4,14-trimethyl-7-triethylsilyloxypentadec-14-enoic acid (PubChem CID 11657784) has the molecular formula C42H66O9Si and a molecular weight of 743.07 g/mol. Its IUPAC name is (2S,3S,4R,7S,9S,11S)-9-acetyloxy-3,11-bis[(4-methoxyphenyl)methoxy]-2,4,14-trimethyl-7-triethylsilyloxypentadec-14-enoic acid.
| Compound Name | (2S,3S,4R,7S,9S,11S)-9-acetyloxy-3,11-bis[(4-methoxyphenyl)methoxy]-2,4,14-trimethyl-7-triethylsilyloxypentadec-14-enoic acid |
|---|---|
| PubChem CID | 11657784 |
| Molecular Formula | C42H66O9Si |
| Molecular Weight | 743.07 g/mol |
| Exact Mass | 742.45 |
| IUPAC Name | (2S,3S,4R,7S,9S,11S)-9-acetyloxy-3,11-bis[(4-methoxyphenyl)methoxy]-2,4,14-trimethyl-7-triethylsilyloxypentadec-14-enoic acid |
| SMILES | C=C(C)CC[C@@H](C[C@@H](C[C@H](CC[C@@H](C)[C@H](OCc1ccc(OC)cc1)[C@H](C)C(=O)O)O[Si](CC)(CC)CC)OC(C)=O)OCc1ccc(OC)cc1 |
| InChI | InChI=1S/C42H66O9Si/c1-11-52(12-2,13-3)51-39(21-15-31(6)41(32(7)42(44)45)49-29-35-18-24-37(47-10)25-19-35)27-40(50-33(8)43)26-38(20-14-30(4)5)48-28-34-16-22-36(46-9)23-17-34/h16-19,22-25,31-32,38-41H,4,11-15,20-21,26-29H2,1-3,5-10H3,(H,44,45)/t31-,32+,38+,39+,40+,41+/m1/s1 |
| InChIKey | MLHLRXAJGYLLDW-KAHFTSKDSA-N |
| XLogP | 9.77 |
| TPSA | 109.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.07 |
| LogP ≤ 5 | 9.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|