About 10-amino-8-ethyl-1,1,1-trifluorodecan-5-one
10-amino-8-ethyl-1,1,1-trifluorodecan-5-one (PubChem CID 116578262) has the molecular formula C12H22F3NO
and a molecular weight of 253.31 g/mol. Its IUPAC name is 10-amino-8-ethyl-1,1,1-trifluorodecan-5-one.
Molecular Properties
| Compound Name | 10-amino-8-ethyl-1,1,1-trifluorodecan-5-one |
| PubChem CID | 116578262 |
| Molecular Formula | C12H22F3NO |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.17 |
| IUPAC Name | 10-amino-8-ethyl-1,1,1-trifluorodecan-5-one |
| SMILES | CCC(CCN)CCC(=O)CCCC(F)(F)F |
| InChI | InChI=1S/C12H22F3NO/c1-2-10(7-9-16)5-6-11(17)4-3-8-12(13,14)15/h10H,2-9,16H2,1H3 |
| InChIKey | XXTCQBFUJJJICJ-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 10-amino-8-ethyl-1,1,1-trifluorodecan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-amino-8-ethyl-1,1,1-trifluorodecan-5-one?
The IUPAC name of 10-amino-8-ethyl-1,1,1-trifluorodecan-5-one (CID 116578262) is 10-amino-8-ethyl-1,1,1-trifluorodecan-5-one.
What is the SMILES notation for 10-amino-8-ethyl-1,1,1-trifluorodecan-5-one?
The canonical SMILES for 10-amino-8-ethyl-1,1,1-trifluorodecan-5-one is CCC(CCN)CCC(=O)CCCC(F)(F)F.
What is the InChIKey of 10-amino-8-ethyl-1,1,1-trifluorodecan-5-one?
The InChIKey is XXTCQBFUJJJICJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22F3NO/c1-2-10(7-9-16)5-6-11(17)4-3-8-12(13,14)15/h10H,2-9,16H2,1H3.
What are the key properties of 10-amino-8-ethyl-1,1,1-trifluorodecan-5-one?
10-amino-8-ethyl-1,1,1-trifluorodecan-5-one has a molecular weight of 253.31 g/mol, XLogP of 3.44, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-amino-8-ethyl-1,1,1-trifluorodecan-5-one is sourced from PubChem (CID 116578262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).