About 9-amino-7-ethyl-1,1,1-trifluorononan-4-one
9-amino-7-ethyl-1,1,1-trifluorononan-4-one (PubChem CID 116578315) has the molecular formula C11H20F3NO
and a molecular weight of 239.28 g/mol. Its IUPAC name is 9-amino-7-ethyl-1,1,1-trifluorononan-4-one.
Molecular Properties
| Compound Name | 9-amino-7-ethyl-1,1,1-trifluorononan-4-one |
| PubChem CID | 116578315 |
| Molecular Formula | C11H20F3NO |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 9-amino-7-ethyl-1,1,1-trifluorononan-4-one |
| SMILES | CCC(CCN)CCC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C11H20F3NO/c1-2-9(6-8-15)3-4-10(16)5-7-11(12,13)14/h9H,2-8,15H2,1H3 |
| InChIKey | VAUKUFBPORAKCV-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-amino-7-ethyl-1,1,1-trifluorononan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-amino-7-ethyl-1,1,1-trifluorononan-4-one?
The IUPAC name of 9-amino-7-ethyl-1,1,1-trifluorononan-4-one (CID 116578315) is 9-amino-7-ethyl-1,1,1-trifluorononan-4-one.
What is the SMILES notation for 9-amino-7-ethyl-1,1,1-trifluorononan-4-one?
The canonical SMILES for 9-amino-7-ethyl-1,1,1-trifluorononan-4-one is CCC(CCN)CCC(=O)CCC(F)(F)F.
What is the InChIKey of 9-amino-7-ethyl-1,1,1-trifluorononan-4-one?
The InChIKey is VAUKUFBPORAKCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20F3NO/c1-2-9(6-8-15)3-4-10(16)5-7-11(12,13)14/h9H,2-8,15H2,1H3.
What are the key properties of 9-amino-7-ethyl-1,1,1-trifluorononan-4-one?
9-amino-7-ethyl-1,1,1-trifluorononan-4-one has a molecular weight of 239.28 g/mol, XLogP of 3.05, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-amino-7-ethyl-1,1,1-trifluorononan-4-one is sourced from PubChem (CID 116578315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).