About 1-(3-aminooxolan-3-yl)-5,5,5-trifluoropentan-1-one
1-(3-aminooxolan-3-yl)-5,5,5-trifluoropentan-1-one (PubChem CID 116579643) has the molecular formula C9H14F3NO2
and a molecular weight of 225.21 g/mol. Its IUPAC name is 1-(3-aminooxolan-3-yl)-5,5,5-trifluoropentan-1-one.
Molecular Properties
| Compound Name | 1-(3-aminooxolan-3-yl)-5,5,5-trifluoropentan-1-one |
| PubChem CID | 116579643 |
| Molecular Formula | C9H14F3NO2 |
| Molecular Weight | 225.21 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | 1-(3-aminooxolan-3-yl)-5,5,5-trifluoropentan-1-one |
| SMILES | NC1(C(=O)CCCC(F)(F)F)CCOC1 |
| InChI | InChI=1S/C9H14F3NO2/c10-9(11,12)3-1-2-7(14)8(13)4-5-15-6-8/h1-6,13H2 |
| InChIKey | KKHFMNCDWRDEKB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.21 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-aminooxolan-3-yl)-5,5,5-trifluoropentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-aminooxolan-3-yl)-5,5,5-trifluoropentan-1-one?
The IUPAC name of 1-(3-aminooxolan-3-yl)-5,5,5-trifluoropentan-1-one (CID 116579643) is 1-(3-aminooxolan-3-yl)-5,5,5-trifluoropentan-1-one.
What is the SMILES notation for 1-(3-aminooxolan-3-yl)-5,5,5-trifluoropentan-1-one?
The canonical SMILES for 1-(3-aminooxolan-3-yl)-5,5,5-trifluoropentan-1-one is NC1(C(=O)CCCC(F)(F)F)CCOC1.
What is the InChIKey of 1-(3-aminooxolan-3-yl)-5,5,5-trifluoropentan-1-one?
The InChIKey is KKHFMNCDWRDEKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO2/c10-9(11,12)3-1-2-7(14)8(13)4-5-15-6-8/h1-6,13H2.
What are the key properties of 1-(3-aminooxolan-3-yl)-5,5,5-trifluoropentan-1-one?
1-(3-aminooxolan-3-yl)-5,5,5-trifluoropentan-1-one has a molecular weight of 225.21 g/mol, XLogP of 1.41, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-aminooxolan-3-yl)-5,5,5-trifluoropentan-1-one is sourced from PubChem (CID 116579643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).